C13H24BN3O2 — CID 172738407
N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine (PubChem CID 172738407) has the molecular formula C13H24BN3O2 and a molecular weight of 265.17 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine.
| Compound Name | N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 172738407 |
| Molecular Formula | C13H24BN3O2 |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethanamine |
| SMILES | CC(N(C)C)n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C13H24BN3O2/c1-10(16(6)7)17-9-11(8-15-17)14-18-12(2,3)13(4,5)19-14/h8-10H,1-7H3 |
| InChIKey | ITJGETRQUMFUGV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|