C19H40B2N4O4P6 — CID 158878284
bis(phosphanyl)-pyrazol-1-ylphosphane;bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane (PubChem CID 158878284) has the molecular formula C19H40B2N4O4P6 and a molecular weight of 596.02 g/mol. Its IUPAC name is bis(phosphanyl)-pyrazol-1-ylphosphane;bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane.
| Compound Name | bis(phosphanyl)-pyrazol-1-ylphosphane;bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158878284 |
| Molecular Formula | C19H40B2N4O4P6 |
| Molecular Weight | 596.02 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | bis(phosphanyl)-pyrazol-1-ylphosphane;bis(phosphanyl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]phosphane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
| SMILES | CB1OC(C)(C)C(C)(C)O1.CC1(C)OB(c2cnn(P(P)P)c2)OC1(C)C.PP(P)n1cccn1 |
| InChI | InChI=1S/C9H18BN2O2P3.C7H15BO2.C3H7N2P3/c1-8(2)9(3,4)14-10(13-8)7-5-11-12(6-7)17(15)16;1-6(2)7(3,4)10-8(5)9-6;6-8(7)5-3-1-2-4-5/h5-6H,15-16H2,1-4H3;1-5H3;1-3H,6-7H2 |
| InChIKey | JCSFQGFOOSAKLN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.02 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|