C14H19BN4O2 — CID 169303747
2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrimidine (PubChem CID 169303747) has the molecular formula C14H19BN4O2 and a molecular weight of 286.14 g/mol. Its IUPAC name is 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrimidine.
| Compound Name | 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrimidine |
|---|---|
| PubChem CID | 169303747 |
| Molecular Formula | C14H19BN4O2 |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]pyrimidine |
| SMILES | Cc1nccc(-n2cc(B3OC(C)(C)C(C)(C)O3)cn2)n1 |
| InChI | InChI=1S/C14H19BN4O2/c1-10-16-7-6-12(18-10)19-9-11(8-17-19)15-20-13(2,3)14(4,5)21-15/h6-9H,1-5H3 |
| InChIKey | MDTPTQJNNNBOCD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|