C16H20BFN2O2 — CID 66521162
1-(4-fluoro-2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 66521162) has the molecular formula C16H20BFN2O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 66521162 |
| Molecular Formula | C16H20BFN2O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1cc(F)ccc1-n1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C16H20BFN2O2/c1-11-8-13(18)6-7-14(11)20-10-12(9-19-20)17-21-15(2,3)16(4,5)22-17/h6-10H,1-5H3 |
| InChIKey | IJICACCGONVWAP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|