C22H30B3F2N2O2P — CID 174062298
CID 174062298 (PubChem CID 174062298) has the molecular formula C22H30B3F2N2O2P and a molecular weight of 455.90 g/mol.
| Compound Name | CID 174062298 |
|---|---|
| PubChem CID | 174062298 |
| Molecular Formula | C22H30B3F2N2O2P |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C)C(P)(c1cc(C)c(-n2cc(B3OC(C)(C)C(C)(C)O3)cn2)c(C)c1)C(C)(F)F |
| InChI | InChI=1S/C22H30B3F2N2O2P/c1-13-9-15(22(32,20(7,23)24)21(8,26)27)10-14(2)17(13)29-12-16(11-28-29)25-30-18(3,4)19(5,6)31-25/h9-12H,32H2,1-8H3 |
| InChIKey | JTEKZKGZSIXGEJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|