C16H27BN2O4 — CID 171891256
4-(methylamino)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butane-1,2-diol (PubChem CID 171891256) has the molecular formula C16H27BN2O4 and a molecular weight of 322.21 g/mol. Its IUPAC name is 4-(methylamino)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butane-1,2-diol.
| Compound Name | 4-(methylamino)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171891256 |
| Molecular Formula | C16H27BN2O4 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-(methylamino)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H27BN2O4/c1-15(2)16(3,4)23-17(22-15)12-8-11(9-19-10-12)14(21)13(20)6-7-18-5/h8-10,13-14,18,20-21H,6-7H2,1-5H3 |
| InChIKey | CYXGGXLTAOJXRW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|