C17H26BNO5S — CID 171876923
S-[3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butyl] ethanethioate (PubChem CID 171876923) has the molecular formula C17H26BNO5S and a molecular weight of 367.28 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butyl] ethanethioate |
|---|---|
| PubChem CID | 171876923 |
| Molecular Formula | C17H26BNO5S |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | S-[3,4-dihydroxy-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]butyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H26BNO5S/c1-11(20)25-7-6-14(21)15(22)12-8-13(10-19-9-12)18-23-16(2,3)17(4,5)24-18/h8-10,14-15,21-22H,6-7H2,1-5H3 |
| InChIKey | DCRBYGISPKOKCQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|