C11H15NO3S — CID 171875294
S-(3,4-dihydroxy-4-pyridin-3-ylbutyl) ethanethioate (PubChem CID 171875294) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is S-(3,4-dihydroxy-4-pyridin-3-ylbutyl) ethanethioate.
| Compound Name | S-(3,4-dihydroxy-4-pyridin-3-ylbutyl) ethanethioate |
|---|---|
| PubChem CID | 171875294 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | S-(3,4-dihydroxy-4-pyridin-3-ylbutyl) ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cccnc1 |
| InChI | InChI=1S/C11H15NO3S/c1-8(13)16-6-4-10(14)11(15)9-3-2-5-12-7-9/h2-3,5,7,10-11,14-15H,4,6H2,1H3 |
| InChIKey | OGUWOTAVWSJFLJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|