C12H16O4S2 — CID 171875497
S-[4-(5-acetylthiophen-2-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875497) has the molecular formula C12H16O4S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is S-[4-(5-acetylthiophen-2-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(5-acetylthiophen-2-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875497 |
| Molecular Formula | C12H16O4S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | S-[4-(5-acetylthiophen-2-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ccc(C(C)=O)s1 |
| InChI | InChI=1S/C12H16O4S2/c1-7(13)10-3-4-11(18-10)12(16)9(15)5-6-17-8(2)14/h3-4,9,12,15-16H,5-6H2,1-2H3 |
| InChIKey | ROWMBGMYSYFTML-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|