About 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid
5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid (PubChem CID 171889802) has the molecular formula C10H15NO4S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid |
| PubChem CID | 171889802 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid |
| SMILES | CNCCC(O)C(O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C10H15NO4S/c1-11-5-4-6(12)9(13)7-2-3-8(16-7)10(14)15/h2-3,6,9,11-13H,4-5H2,1H3,(H,14,15) |
| InChIKey | OIMMCFKJCXCGLL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid (CID 171889802) is 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid is CNCCC(O)C(O)c1ccc(C(=O)O)s1.
What is the InChIKey of 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid?
The InChIKey is OIMMCFKJCXCGLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4S/c1-11-5-4-6(12)9(13)7-2-3-8(16-7)10(14)15/h2-3,6,9,11-13H,4-5H2,1H3,(H,14,15).
What are the key properties of 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid?
5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid has a molecular weight of 245.30 g/mol, XLogP of 0.45, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1,2-dihydroxy-4-(methylamino)butyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 171889802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).