methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate

C10H13ClO4S — CID 171893656

IUPACmethyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(C(O)C(O)CCCl)s1
InChIInChI=1S/C10H13ClO4S/c1-15-10(14)8-3-2-7(16-8)9(13)6(12)4-5-11/h2-3,6,9,12-13H,4-5H2,1H3
InChIKeyPIAFDCKXZAYCJY-UHFFFAOYSA-N
MW264.73 g/mol
LogP1.56
Rot. Bonds5

About methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate

methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate (PubChem CID 171893656) has the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. Its IUPAC name is methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate
PubChem CID171893656
Molecular FormulaC10H13ClO4S
Molecular Weight264.73 g/mol
Exact Mass264.02
IUPAC Namemethyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate
SMILESCOC(=O)c1ccc(C(O)C(O)CCCl)s1
InChIInChI=1S/C10H13ClO4S/c1-15-10(14)8-3-2-7(16-8)9(13)6(12)4-5-11/h2-3,6,9,12-13H,4-5H2,1H3
InChIKeyPIAFDCKXZAYCJY-UHFFFAOYSA-N
XLogP1.56
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.73
LogP ≤ 51.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate?
The IUPAC name of methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate (CID 171893656) is methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate?
The canonical SMILES for methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate is COC(=O)c1ccc(C(O)C(O)CCCl)s1.
What is the InChIKey of methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate?
The InChIKey is PIAFDCKXZAYCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO4S/c1-15-10(14)8-3-2-7(16-8)9(13)6(12)4-5-11/h2-3,6,9,12-13H,4-5H2,1H3.
What are the key properties of methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate?
methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate has a molecular weight of 264.73 g/mol, XLogP of 1.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate is sourced from PubChem (CID 171893656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).