C10H13ClO4S — CID 171893656
methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate (PubChem CID 171893656) has the molecular formula C10H13ClO4S and a molecular weight of 264.73 g/mol. Its IUPAC name is methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate.
| Compound Name | methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 171893656 |
| Molecular Formula | C10H13ClO4S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | methyl 5-(4-chloro-1,2-dihydroxybutyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CCCl)s1 |
| InChI | InChI=1S/C10H13ClO4S/c1-15-10(14)8-3-2-7(16-8)9(13)6(12)4-5-11/h2-3,6,9,12-13H,4-5H2,1H3 |
| InChIKey | PIAFDCKXZAYCJY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|