C12H17NO5S — CID 171882905
methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate (PubChem CID 171882905) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate.
| Compound Name | methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 171882905 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CCNC(C)=O)s1 |
| InChI | InChI=1S/C12H17NO5S/c1-7(14)13-6-5-8(15)11(16)9-3-4-10(19-9)12(17)18-2/h3-4,8,11,15-16H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | RLGFBWOJMZKIOC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |