About methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate
methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate (PubChem CID 171882905) has the molecular formula C12H17NO5S
and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate |
| PubChem CID | 171882905 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CCNC(C)=O)s1 |
| InChI | InChI=1S/C12H17NO5S/c1-7(14)13-6-5-8(15)11(16)9-3-4-10(19-9)12(17)18-2/h3-4,8,11,15-16H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | RLGFBWOJMZKIOC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate?
The IUPAC name of methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate (CID 171882905) is methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate?
The canonical SMILES for methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate is COC(=O)c1ccc(C(O)C(O)CCNC(C)=O)s1.
What is the InChIKey of methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate?
The InChIKey is RLGFBWOJMZKIOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5S/c1-7(14)13-6-5-8(15)11(16)9-3-4-10(19-9)12(17)18-2/h3-4,8,11,15-16H,5-6H2,1-2H3,(H,13,14).
What are the key properties of methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate?
methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate has a molecular weight of 287.34 g/mol, XLogP of 0.46, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-acetamido-1,2-dihydroxybutyl)thiophene-2-carboxylate is sourced from PubChem (CID 171882905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).