C11H15NO4S — CID 171882482
N-[4-(5-formylthiophen-2-yl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882482) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-[4-(5-formylthiophen-2-yl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(5-formylthiophen-2-yl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882482 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[4-(5-formylthiophen-2-yl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(C=O)s1 |
| InChI | InChI=1S/C11H15NO4S/c1-7(14)12-5-4-9(15)11(16)10-3-2-8(6-13)17-10/h2-3,6,9,11,15-16H,4-5H2,1H3,(H,12,14) |
| InChIKey | GGVCAPJTHOLSNI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|