C11H15NO5 — CID 171882477
N-[4-(5-formylfuran-2-yl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882477) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is N-[4-(5-formylfuran-2-yl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(5-formylfuran-2-yl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882477 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-[4-(5-formylfuran-2-yl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(C=O)o1 |
| InChI | InChI=1S/C11H15NO5/c1-7(14)12-5-4-9(15)11(16)10-3-2-8(6-13)17-10/h2-3,6,9,11,15-16H,4-5H2,1H3,(H,12,14) |
| InChIKey | IHBCOSSXAUVYQM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|