C16H25NO3 — CID 171883301
N-[3,4-dihydroxy-4-[4-(2-methylpropyl)phenyl]butyl]acetamide (PubChem CID 171883301) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[3,4-dihydroxy-4-[4-(2-methylpropyl)phenyl]butyl]acetamide.
| Compound Name | N-[3,4-dihydroxy-4-[4-(2-methylpropyl)phenyl]butyl]acetamide |
|---|---|
| PubChem CID | 171883301 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-[3,4-dihydroxy-4-[4-(2-methylpropyl)phenyl]butyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C16H25NO3/c1-11(2)10-13-4-6-14(7-5-13)16(20)15(19)8-9-17-12(3)18/h4-7,11,15-16,19-20H,8-10H2,1-3H3,(H,17,18) |
| InChIKey | HQXVADCTGOMWMJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |