C13H16ClNO4 — CID 171882953
N-[4-(2-chloro-5-formylphenyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882953) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is N-[4-(2-chloro-5-formylphenyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(2-chloro-5-formylphenyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882953 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[4-(2-chloro-5-formylphenyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cc(C=O)ccc1Cl |
| InChI | InChI=1S/C13H16ClNO4/c1-8(17)15-5-4-12(18)13(19)10-6-9(7-16)2-3-11(10)14/h2-3,6-7,12-13,18-19H,4-5H2,1H3,(H,15,17) |
| InChIKey | OYTIZFZTNUZBNV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|