C8H9ClO4S — CID 171861620
5-(3-chloro-1,2-dihydroxypropyl)thiophene-2-carboxylic acid (PubChem CID 171861620) has the molecular formula C8H9ClO4S and a molecular weight of 236.68 g/mol. Its IUPAC name is 5-(3-chloro-1,2-dihydroxypropyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(3-chloro-1,2-dihydroxypropyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 171861620 |
| Molecular Formula | C8H9ClO4S |
| Molecular Weight | 236.68 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 5-(3-chloro-1,2-dihydroxypropyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(O)C(O)CCl)s1 |
| InChI | InChI=1S/C8H9ClO4S/c9-3-4(10)7(11)5-1-2-6(14-5)8(12)13/h1-2,4,7,10-11H,3H2,(H,12,13) |
| InChIKey | HCOQRWLMXHRYMT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|