C13H13ClO2S — CID 171862758
3-chloro-1-(5-phenylthiophen-2-yl)propane-1,2-diol (PubChem CID 171862758) has the molecular formula C13H13ClO2S and a molecular weight of 268.76 g/mol. Its IUPAC name is 3-chloro-1-(5-phenylthiophen-2-yl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(5-phenylthiophen-2-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 171862758 |
| Molecular Formula | C13H13ClO2S |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-chloro-1-(5-phenylthiophen-2-yl)propane-1,2-diol |
| SMILES | OC(CCl)C(O)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C13H13ClO2S/c14-8-10(15)13(16)12-7-6-11(17-12)9-4-2-1-3-5-9/h1-7,10,13,15-16H,8H2 |
| InChIKey | XHZRMHVJDJPCIH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|