C12H16O5S2 — CID 171874976
4-[5-(1,2-dihydroxy-4-sulfanylbutyl)thiophen-2-yl]-4-oxobutanoic acid (PubChem CID 171874976) has the molecular formula C12H16O5S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[5-(1,2-dihydroxy-4-sulfanylbutyl)thiophen-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-(1,2-dihydroxy-4-sulfanylbutyl)thiophen-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 171874976 |
| Molecular Formula | C12H16O5S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-[5-(1,2-dihydroxy-4-sulfanylbutyl)thiophen-2-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc(C(O)C(O)CCS)s1 |
| InChI | InChI=1S/C12H16O5S2/c13-7(1-4-11(15)16)9-2-3-10(19-9)12(17)8(14)5-6-18/h2-3,8,12,14,17-18H,1,4-6H2,(H,15,16) |
| InChIKey | XPEUTWCHBXTNAD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|