C8H13NO4S3 — CID 171874193
5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide (PubChem CID 171874193) has the molecular formula C8H13NO4S3 and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide.
| Compound Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 171874193 |
| Molecular Formula | C8H13NO4S3 |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(O)C(O)CCS)s1 |
| InChI | InChI=1S/C8H13NO4S3/c9-16(12,13)7-2-1-6(15-7)8(11)5(10)3-4-14/h1-2,5,8,10-11,14H,3-4H2,(H2,9,12,13) |
| InChIKey | ZBXHYTRVRZYWEZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|