About 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide
5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide (PubChem CID 171874193) has the molecular formula C8H13NO4S3
and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide |
| PubChem CID | 171874193 |
| Molecular Formula | C8H13NO4S3 |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(O)C(O)CCS)s1 |
| InChI | InChI=1S/C8H13NO4S3/c9-16(12,13)7-2-1-6(15-7)8(11)5(10)3-4-14/h1-2,5,8,10-11,14H,3-4H2,(H2,9,12,13) |
| InChIKey | ZBXHYTRVRZYWEZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide?
The IUPAC name of 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide (CID 171874193) is 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide?
The canonical SMILES for 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide is NS(=O)(=O)c1ccc(C(O)C(O)CCS)s1.
What is the InChIKey of 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide?
The InChIKey is ZBXHYTRVRZYWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4S3/c9-16(12,13)7-2-1-6(15-7)8(11)5(10)3-4-14/h1-2,5,8,10-11,14H,3-4H2,(H2,9,12,13).
What are the key properties of 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide?
5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide has a molecular weight of 283.40 g/mol, XLogP of 0.11, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-dihydroxy-4-sulfanylbutyl)thiophene-2-sulfonamide is sourced from PubChem (CID 171874193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).