C10H14O5S2 — CID 171875231
2-(1,2-dihydroxy-4-sulfanylbutyl)benzenesulfonic acid (PubChem CID 171875231) has the molecular formula C10H14O5S2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(1,2-dihydroxy-4-sulfanylbutyl)benzenesulfonic acid.
| Compound Name | 2-(1,2-dihydroxy-4-sulfanylbutyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 171875231 |
| Molecular Formula | C10H14O5S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-(1,2-dihydroxy-4-sulfanylbutyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1C(O)C(O)CCS |
| InChI | InChI=1S/C10H14O5S2/c11-8(5-6-16)10(12)7-3-1-2-4-9(7)17(13,14)15/h1-4,8,10-12,16H,5-6H2,(H,13,14,15) |
| InChIKey | ZHJBEBOJMXDZOU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|