C11H16O3S — CID 171873724
1-(3-hydroxy-2-methylphenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873724) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 1-(3-hydroxy-2-methylphenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(3-hydroxy-2-methylphenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873724 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-(3-hydroxy-2-methylphenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | Cc1c(O)cccc1C(O)C(O)CCS |
| InChI | InChI=1S/C11H16O3S/c1-7-8(3-2-4-9(7)12)11(14)10(13)5-6-15/h2-4,10-15H,5-6H2,1H3 |
| InChIKey | RZLCACMIYICUOE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|