C12H16O4S — CID 171874401
2-[2-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]acetic acid (PubChem CID 171874401) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-[2-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]acetic acid.
| Compound Name | 2-[2-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 171874401 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[2-(1,2-dihydroxy-4-sulfanylbutyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1C(O)C(O)CCS |
| InChI | InChI=1S/C12H16O4S/c13-10(5-6-17)12(16)9-4-2-1-3-8(9)7-11(14)15/h1-4,10,12-13,16-17H,5-7H2,(H,14,15) |
| InChIKey | NTTZIACHHVLDOE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|