C13H18O5 — CID 171872872
methyl 2-[2-(1,2,4-trihydroxybutyl)phenyl]acetate (PubChem CID 171872872) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl 2-[2-(1,2,4-trihydroxybutyl)phenyl]acetate.
| Compound Name | methyl 2-[2-(1,2,4-trihydroxybutyl)phenyl]acetate |
|---|---|
| PubChem CID | 171872872 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | methyl 2-[2-(1,2,4-trihydroxybutyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccccc1C(O)C(O)CCO |
| InChI | InChI=1S/C13H18O5/c1-18-12(16)8-9-4-2-3-5-10(9)13(17)11(15)6-7-14/h2-5,11,13-15,17H,6-8H2,1H3 |
| InChIKey | NOCVTIGLBYYMLR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |