methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate

C14H17NO4 — CID 171901825

IUPACmethyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate
SMILESCOC(=O)CCc1ccccc1C(O)C(O)CC#N
InChIInChI=1S/C14H17NO4/c1-19-13(17)7-6-10-4-2-3-5-11(10)14(18)12(16)8-9-15/h2-5,12,14,16,18H,6-8H2,1H3
InChIKeyIXKPMQQUUUDQQN-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.10
Rot. Bonds6

About methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate

methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate (PubChem CID 171901825) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate.

Molecular Properties

Compound Namemethyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate
PubChem CID171901825
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Namemethyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate
SMILESCOC(=O)CCc1ccccc1C(O)C(O)CC#N
InChIInChI=1S/C14H17NO4/c1-19-13(17)7-6-10-4-2-3-5-11(10)14(18)12(16)8-9-15/h2-5,12,14,16,18H,6-8H2,1H3
InChIKeyIXKPMQQUUUDQQN-UHFFFAOYSA-N
XLogP1.10
TPSA90.55 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate?
The IUPAC name of methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate (CID 171901825) is methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate.
What is the SMILES notation for methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate?
The canonical SMILES for methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate is COC(=O)CCc1ccccc1C(O)C(O)CC#N.
What is the InChIKey of methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate?
The InChIKey is IXKPMQQUUUDQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-19-13(17)7-6-10-4-2-3-5-11(10)14(18)12(16)8-9-15/h2-5,12,14,16,18H,6-8H2,1H3.
What are the key properties of methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate?
methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate has a molecular weight of 263.29 g/mol, XLogP of 1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate is sourced from PubChem (CID 171901825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).