C14H17NO4 — CID 171901825
methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate (PubChem CID 171901825) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate.
| Compound Name | methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171901825 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 3-[2-(3-cyano-1,2-dihydroxypropyl)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccccc1C(O)C(O)CC#N |
| InChI | InChI=1S/C14H17NO4/c1-19-13(17)7-6-10-4-2-3-5-11(10)14(18)12(16)8-9-15/h2-5,12,14,16,18H,6-8H2,1H3 |
| InChIKey | IXKPMQQUUUDQQN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |