C11H13NO2 — CID 79118792
3-hydroxy-3-[2-(methoxymethyl)phenyl]propanenitrile (PubChem CID 79118792) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-hydroxy-3-[2-(methoxymethyl)phenyl]propanenitrile.
| Compound Name | 3-hydroxy-3-[2-(methoxymethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 79118792 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-hydroxy-3-[2-(methoxymethyl)phenyl]propanenitrile |
| SMILES | COCc1ccccc1C(O)CC#N |
| InChI | InChI=1S/C11H13NO2/c1-14-8-9-4-2-3-5-10(9)11(13)6-7-12/h2-5,11,13H,6,8H2,1H3 |
| InChIKey | IZFRXHAXDVJDGX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |