C12H13NO4 — CID 171901251
methyl 4-(3-cyano-1,2-dihydroxypropyl)benzoate (PubChem CID 171901251) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 4-(3-cyano-1,2-dihydroxypropyl)benzoate.
| Compound Name | methyl 4-(3-cyano-1,2-dihydroxypropyl)benzoate |
|---|---|
| PubChem CID | 171901251 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 4-(3-cyano-1,2-dihydroxypropyl)benzoate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CC#N)cc1 |
| InChI | InChI=1S/C12H13NO4/c1-17-12(16)9-4-2-8(3-5-9)11(15)10(14)6-7-13/h2-5,10-11,14-15H,6H2,1H3 |
| InChIKey | KSERFWDUMXLTSF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |