C12H16N2O2 — CID 171901028
4-[4-(dimethylamino)phenyl]-3,4-dihydroxybutanenitrile (PubChem CID 171901028) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-3,4-dihydroxybutanenitrile.
| Compound Name | 4-[4-(dimethylamino)phenyl]-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901028 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-3,4-dihydroxybutanenitrile |
| SMILES | CN(C)c1ccc(C(O)C(O)CC#N)cc1 |
| InChI | InChI=1S/C12H16N2O2/c1-14(2)10-5-3-9(4-6-10)12(16)11(15)7-8-13/h3-6,11-12,15-16H,7H2,1-2H3 |
| InChIKey | HPEKJJQFWSYOBN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|