C22H26O3 — CID 122202400
methyl 4-[(1R,2S)-4-ethyl-1-hydroxy-1-phenylhex-3-en-2-yl]benzoate (PubChem CID 122202400) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl 4-[(1R,2S)-4-ethyl-1-hydroxy-1-phenylhex-3-en-2-yl]benzoate.
| Compound Name | methyl 4-[(1R,2S)-4-ethyl-1-hydroxy-1-phenylhex-3-en-2-yl]benzoate |
|---|---|
| PubChem CID | 122202400 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | methyl 4-[(1R,2S)-4-ethyl-1-hydroxy-1-phenylhex-3-en-2-yl]benzoate |
| SMILES | CCC(=C[C@@H](c1ccc(C(=O)OC)cc1)[C@@H](O)c1ccccc1)CC |
| InChI | InChI=1S/C22H26O3/c1-4-16(5-2)15-20(21(23)18-9-7-6-8-10-18)17-11-13-19(14-12-17)22(24)25-3/h6-15,20-21,23H,4-5H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | HUCRVUFEIDQKQU-SFTDATJTSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|