C23H23O6P — CID 102186420
methyl 4-[bis(phenylmethoxy)phosphoryl-hydroxymethyl]benzoate (PubChem CID 102186420) has the molecular formula C23H23O6P and a molecular weight of 426.41 g/mol. Its IUPAC name is methyl 4-[bis(phenylmethoxy)phosphoryl-hydroxymethyl]benzoate.
| Compound Name | methyl 4-[bis(phenylmethoxy)phosphoryl-hydroxymethyl]benzoate |
|---|---|
| PubChem CID | 102186420 |
| Molecular Formula | C23H23O6P |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | methyl 4-[bis(phenylmethoxy)phosphoryl-hydroxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(O)P(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23O6P/c1-27-22(24)20-12-14-21(15-13-20)23(25)30(26,28-16-18-8-4-2-5-9-18)29-17-19-10-6-3-7-11-19/h2-15,23,25H,16-17H2,1H3 |
| InChIKey | WNPPLJDGTGDZMP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|