C12H17ClO3 — CID 171893748
4-chloro-1-[2-(2-hydroxyethyl)phenyl]butane-1,2-diol (PubChem CID 171893748) has the molecular formula C12H17ClO3 and a molecular weight of 244.72 g/mol. Its IUPAC name is 4-chloro-1-[2-(2-hydroxyethyl)phenyl]butane-1,2-diol.
| Compound Name | 4-chloro-1-[2-(2-hydroxyethyl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171893748 |
| Molecular Formula | C12H17ClO3 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4-chloro-1-[2-(2-hydroxyethyl)phenyl]butane-1,2-diol |
| SMILES | OCCc1ccccc1C(O)C(O)CCCl |
| InChI | InChI=1S/C12H17ClO3/c13-7-5-11(15)12(16)10-4-2-1-3-9(10)6-8-14/h1-4,11-12,14-16H,5-8H2 |
| InChIKey | AFGQOUMANVESQR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|