C12H18BrNO2 — CID 171892067
1-[2-(2-aminoethyl)phenyl]-4-bromobutane-1,2-diol (PubChem CID 171892067) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 1-[2-(2-aminoethyl)phenyl]-4-bromobutane-1,2-diol.
| Compound Name | 1-[2-(2-aminoethyl)phenyl]-4-bromobutane-1,2-diol |
|---|---|
| PubChem CID | 171892067 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-[2-(2-aminoethyl)phenyl]-4-bromobutane-1,2-diol |
| SMILES | NCCc1ccccc1C(O)C(O)CCBr |
| InChI | InChI=1S/C12H18BrNO2/c13-7-5-11(15)12(16)10-4-2-1-3-9(10)6-8-14/h1-4,11-12,15-16H,5-8,14H2 |
| InChIKey | SAINYUBHOFPBBQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|