C11H14BrClO3 — CID 171891894
4-bromo-1-[4-chloro-2-(hydroxymethyl)phenyl]butane-1,2-diol (PubChem CID 171891894) has the molecular formula C11H14BrClO3 and a molecular weight of 309.59 g/mol. Its IUPAC name is 4-bromo-1-[4-chloro-2-(hydroxymethyl)phenyl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[4-chloro-2-(hydroxymethyl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171891894 |
| Molecular Formula | C11H14BrClO3 |
| Molecular Weight | 309.59 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 4-bromo-1-[4-chloro-2-(hydroxymethyl)phenyl]butane-1,2-diol |
| SMILES | OCc1cc(Cl)ccc1C(O)C(O)CCBr |
| InChI | InChI=1S/C11H14BrClO3/c12-4-3-10(15)11(16)9-2-1-8(13)5-7(9)6-14/h1-2,5,10-11,14-16H,3-4,6H2 |
| InChIKey | IZGSBWWKNWYTSR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|