C9H10ClF2NO — CID 142148919
[2-(1-amino-2,2-difluoroethyl)-5-chlorophenyl]methanol (PubChem CID 142148919) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is [2-(1-amino-2,2-difluoroethyl)-5-chlorophenyl]methanol.
| Compound Name | [2-(1-amino-2,2-difluoroethyl)-5-chlorophenyl]methanol |
|---|---|
| PubChem CID | 142148919 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | [2-(1-amino-2,2-difluoroethyl)-5-chlorophenyl]methanol |
| SMILES | NC(c1ccc(Cl)cc1CO)C(F)F |
| InChI | InChI=1S/C9H10ClF2NO/c10-6-1-2-7(5(3-6)4-14)8(13)9(11)12/h1-3,8-9,14H,4,13H2 |
| InChIKey | WFCNGWHWIZXBSG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |