C13H15BrN2O2 — CID 171892768
4-bromo-1-[2-(1H-pyrazol-5-yl)phenyl]butane-1,2-diol (PubChem CID 171892768) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-bromo-1-[2-(1H-pyrazol-5-yl)phenyl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[2-(1H-pyrazol-5-yl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171892768 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-bromo-1-[2-(1H-pyrazol-5-yl)phenyl]butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1ccccc1-c1ccn[nH]1 |
| InChI | InChI=1S/C13H15BrN2O2/c14-7-5-12(17)13(18)10-4-2-1-3-9(10)11-6-8-15-16-11/h1-4,6,8,12-13,17-18H,5,7H2,(H,15,16) |
| InChIKey | UBFFRSMAANZJCA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|