C9H12BrNO3 — CID 171891513
4-bromo-1-(3-hydroxy-2-pyridinyl)butane-1,2-diol (PubChem CID 171891513) has the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. Its IUPAC name is 4-bromo-1-(3-hydroxy-2-pyridinyl)butane-1,2-diol.
| Compound Name | 4-bromo-1-(3-hydroxy-2-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891513 |
| Molecular Formula | C9H12BrNO3 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4-bromo-1-(3-hydroxy-2-pyridinyl)butane-1,2-diol |
| SMILES | Oc1cccnc1C(O)C(O)CCBr |
| InChI | InChI=1S/C9H12BrNO3/c10-4-3-7(13)9(14)8-6(12)2-1-5-11-8/h1-2,5,7,9,12-14H,3-4H2 |
| InChIKey | DNENWOSFKPHTLZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|