C9H12N2O4 — CID 171898678
3,4-dihydroxy-4-(3-hydroxy-2-pyridinyl)butanamide (PubChem CID 171898678) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(3-hydroxy-2-pyridinyl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(3-hydroxy-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 171898678 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 3,4-dihydroxy-4-(3-hydroxy-2-pyridinyl)butanamide |
| SMILES | NC(=O)CC(O)C(O)c1ncccc1O |
| InChI | InChI=1S/C9H12N2O4/c10-7(14)4-6(13)9(15)8-5(12)2-1-3-11-8/h1-3,6,9,12-13,15H,4H2,(H2,10,14) |
| InChIKey | YELHGDCAXTZJJN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |