C10H11F3N2O3 — CID 171899581
3,4-dihydroxy-4-[3-(trifluoromethyl)-2-pyridinyl]butanamide (PubChem CID 171899581) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[3-(trifluoromethyl)-2-pyridinyl]butanamide.
| Compound Name | 3,4-dihydroxy-4-[3-(trifluoromethyl)-2-pyridinyl]butanamide |
|---|---|
| PubChem CID | 171899581 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3,4-dihydroxy-4-[3-(trifluoromethyl)-2-pyridinyl]butanamide |
| SMILES | NC(=O)CC(O)C(O)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O3/c11-10(12,13)5-2-1-3-15-8(5)9(18)6(16)4-7(14)17/h1-3,6,9,16,18H,4H2,(H2,14,17) |
| InChIKey | YYGNRJDXYJFGLB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |