C10H10ClF3N2O3 — CID 171900326
4-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]-3,4-dihydroxybutanamide (PubChem CID 171900326) has the molecular formula C10H10ClF3N2O3 and a molecular weight of 298.65 g/mol. Its IUPAC name is 4-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171900326 |
| Molecular Formula | C10H10ClF3N2O3 |
| Molecular Weight | 298.65 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-[2-chloro-5-(trifluoromethyl)-4-pyridinyl]-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1cc(Cl)ncc1C(F)(F)F |
| InChI | InChI=1S/C10H10ClF3N2O3/c11-7-1-4(5(3-16-7)10(12,13)14)9(19)6(17)2-8(15)18/h1,3,6,9,17,19H,2H2,(H2,15,18) |
| InChIKey | ZSFSEYJAZFFXIV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.65 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|