C12H12F3NO4 — CID 171900047
4-[4-formyl-3-(trifluoromethyl)phenyl]-3,4-dihydroxybutanamide (PubChem CID 171900047) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 4-[4-formyl-3-(trifluoromethyl)phenyl]-3,4-dihydroxybutanamide.
| Compound Name | 4-[4-formyl-3-(trifluoromethyl)phenyl]-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171900047 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-[4-formyl-3-(trifluoromethyl)phenyl]-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO4/c13-12(14,15)8-3-6(1-2-7(8)5-17)11(20)9(18)4-10(16)19/h1-3,5,9,11,18,20H,4H2,(H2,16,19) |
| InChIKey | JRTQIHCQUJODDG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|