C9H14N4O3 — CID 171898981
3,4-dihydroxy-4-[2-(methylamino)pyrimidin-5-yl]butanamide (PubChem CID 171898981) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[2-(methylamino)pyrimidin-5-yl]butanamide.
| Compound Name | 3,4-dihydroxy-4-[2-(methylamino)pyrimidin-5-yl]butanamide |
|---|---|
| PubChem CID | 171898981 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3,4-dihydroxy-4-[2-(methylamino)pyrimidin-5-yl]butanamide |
| SMILES | CNc1ncc(C(O)C(O)CC(N)=O)cn1 |
| InChI | InChI=1S/C9H14N4O3/c1-11-9-12-3-5(4-13-9)8(16)6(14)2-7(10)15/h3-4,6,8,14,16H,2H2,1H3,(H2,10,15)(H,11,12,13) |
| InChIKey | PZUFBIZRPYZVBA-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |