C10H12BrN3O2 — CID 171892192
4-bromo-1-imidazo[1,2-a]pyrimidin-3-ylbutane-1,2-diol (PubChem CID 171892192) has the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is 4-bromo-1-imidazo[1,2-a]pyrimidin-3-ylbutane-1,2-diol.
| Compound Name | 4-bromo-1-imidazo[1,2-a]pyrimidin-3-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 171892192 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 4-bromo-1-imidazo[1,2-a]pyrimidin-3-ylbutane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1cnc2ncccn12 |
| InChI | InChI=1S/C10H12BrN3O2/c11-3-2-8(15)9(16)7-6-13-10-12-4-1-5-14(7)10/h1,4-6,8-9,15-16H,2-3H2 |
| InChIKey | JQABQGLQIPSAHN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|