C11H13N3O4 — CID 171895773
methyl 3,4-dihydroxy-4-imidazo[1,2-a]pyrimidin-3-ylbutanoate (PubChem CID 171895773) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-imidazo[1,2-a]pyrimidin-3-ylbutanoate.
| Compound Name | methyl 3,4-dihydroxy-4-imidazo[1,2-a]pyrimidin-3-ylbutanoate |
|---|---|
| PubChem CID | 171895773 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | methyl 3,4-dihydroxy-4-imidazo[1,2-a]pyrimidin-3-ylbutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cnc2ncccn12 |
| InChI | InChI=1S/C11H13N3O4/c1-18-9(16)5-8(15)10(17)7-6-13-11-12-3-2-4-14(7)11/h2-4,6,8,10,15,17H,5H2,1H3 |
| InChIKey | KXFFSVMACYKZSK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |