C9H10BrF3N2O2 — CID 171892373
4-bromo-1-[2-(trifluoromethyl)pyrimidin-5-yl]butane-1,2-diol (PubChem CID 171892373) has the molecular formula C9H10BrF3N2O2 and a molecular weight of 315.09 g/mol. Its IUPAC name is 4-bromo-1-[2-(trifluoromethyl)pyrimidin-5-yl]butane-1,2-diol.
| Compound Name | 4-bromo-1-[2-(trifluoromethyl)pyrimidin-5-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 171892373 |
| Molecular Formula | C9H10BrF3N2O2 |
| Molecular Weight | 315.09 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 4-bromo-1-[2-(trifluoromethyl)pyrimidin-5-yl]butane-1,2-diol |
| SMILES | OC(CCBr)C(O)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C9H10BrF3N2O2/c10-2-1-6(16)7(17)5-3-14-8(15-4-5)9(11,12)13/h3-4,6-7,16-17H,1-2H2 |
| InChIKey | ZFDHYPNYMTXMPD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.09 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|