C8H5F3N2O — CID 141463807
1-[2-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol (PubChem CID 141463807) has the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol.
| Compound Name | 1-[2-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 141463807 |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 1-[2-(trifluoromethyl)pyrimidin-5-yl]prop-2-yn-1-ol |
| SMILES | C#CC(O)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C8H5F3N2O/c1-2-6(14)5-3-12-7(13-4-5)8(9,10)11/h1,3-4,6,14H |
| InChIKey | YHSMBCHIIYIWJQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|