C10H5F5O — CID 18175677
1-[2,6-difluoro-4-(trifluoromethyl)phenyl]prop-2-yn-1-ol (PubChem CID 18175677) has the molecular formula C10H5F5O and a molecular weight of 236.14 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-(trifluoromethyl)phenyl]prop-2-yn-1-ol.
| Compound Name | 1-[2,6-difluoro-4-(trifluoromethyl)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 18175677 |
| Molecular Formula | C10H5F5O |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 1-[2,6-difluoro-4-(trifluoromethyl)phenyl]prop-2-yn-1-ol |
| SMILES | C#CC(O)c1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C10H5F5O/c1-2-8(16)9-6(11)3-5(4-7(9)12)10(13,14)15/h1,3-4,8,16H |
| InChIKey | AGKQXUUMJNNUGD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|