C11H9ClF7N — CID 171235756
(1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]prop-2-en-1-amine;hydrochloride (PubChem CID 171235756) has the molecular formula C11H9ClF7N and a molecular weight of 323.64 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171235756 |
| Molecular Formula | C11H9ClF7N |
| Molecular Weight | 323.64 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (1S)-1-[2-fluoro-4,6-bis(trifluoromethyl)phenyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=C[C@H](N)c1c(F)cc(C(F)(F)F)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C11H8F7N.ClH/c1-2-8(19)9-6(11(16,17)18)3-5(4-7(9)12)10(13,14)15;/h2-4,8H,1,19H2;1H/t8-;/m0./s1 |
| InChIKey | LRJKGEAXSJKNGP-QRPNPIFTSA-N |
| XLogP | 4.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|