C10H9BrF3N — CID 131485773
(1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]prop-2-en-1-amine (PubChem CID 131485773) has the molecular formula C10H9BrF3N and a molecular weight of 280.09 g/mol. Its IUPAC name is (1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]prop-2-en-1-amine.
| Compound Name | (1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 131485773 |
| Molecular Formula | C10H9BrF3N |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | (1R)-1-[3-bromo-5-(trifluoromethyl)phenyl]prop-2-en-1-amine |
| SMILES | C=C[C@@H](N)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9BrF3N/c1-2-9(15)6-3-7(10(12,13)14)5-8(11)4-6/h2-5,9H,1,15H2/t9-/m1/s1 |
| InChIKey | XNDPJLAOLSIKQX-SECBINFHSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|