C13H16BrF3N2 — CID 171314429
(R)-[3-bromo-5-(trifluoromethyl)phenyl]-piperidin-4-ylmethanamine (PubChem CID 171314429) has the molecular formula C13H16BrF3N2 and a molecular weight of 337.18 g/mol. Its IUPAC name is (R)-[3-bromo-5-(trifluoromethyl)phenyl]-piperidin-4-ylmethanamine.
| Compound Name | (R)-[3-bromo-5-(trifluoromethyl)phenyl]-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 171314429 |
| Molecular Formula | C13H16BrF3N2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (R)-[3-bromo-5-(trifluoromethyl)phenyl]-piperidin-4-ylmethanamine |
| SMILES | N[C@@H](c1cc(Br)cc(C(F)(F)F)c1)C1CCNCC1 |
| InChI | InChI=1S/C13H16BrF3N2/c14-11-6-9(5-10(7-11)13(15,16)17)12(18)8-1-3-19-4-2-8/h5-8,12,19H,1-4,18H2/t12-/m1/s1 |
| InChIKey | SFAKNIHXRIVRJE-GFCCVEGCSA-N |
| XLogP | 3.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |