C11H12ClF4N — CID 138986249
cyclopropyl-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride (PubChem CID 138986249) has the molecular formula C11H12ClF4N and a molecular weight of 269.67 g/mol. Its IUPAC name is cyclopropyl-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride.
| Compound Name | cyclopropyl-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 138986249 |
| Molecular Formula | C11H12ClF4N |
| Molecular Weight | 269.67 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | cyclopropyl-[3-fluoro-5-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| SMILES | Cl.NC(c1cc(F)cc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C11H11F4N.ClH/c12-9-4-7(10(16)6-1-2-6)3-8(5-9)11(13,14)15;/h3-6,10H,1-2,16H2;1H |
| InChIKey | QCMMIFWNTCLOGL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |